C13H29NO2S — CID 18735834
N-(3,3-dimethylbutyl)-N-propylbutane-1-sulfonamide (PubChem CID 18735834) has the molecular formula C13H29NO2S and a molecular weight of 263.45 g/mol. Its IUPAC name is N-(3,3-dimethylbutyl)-N-propylbutane-1-sulfonamide.
| Compound Name | N-(3,3-dimethylbutyl)-N-propylbutane-1-sulfonamide |
|---|---|
| PubChem CID | 18735834 |
| Molecular Formula | C13H29NO2S |
| Molecular Weight | 263.45 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | N-(3,3-dimethylbutyl)-N-propylbutane-1-sulfonamide |
| SMILES | CCCCS(=O)(=O)N(CCC)CCC(C)(C)C |
| InChI | InChI=1S/C13H29NO2S/c1-6-8-12-17(15,16)14(10-7-2)11-9-13(3,4)5/h6-12H2,1-5H3 |
| InChIKey | NCIJDSUVPJOKCY-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.45 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |