C12H28N2O2S — CID 62009247
N-(1-amino-2-methylbutan-2-yl)-N-propylbutane-1-sulfonamide (PubChem CID 62009247) has the molecular formula C12H28N2O2S and a molecular weight of 264.43 g/mol. Its IUPAC name is N-(1-amino-2-methylbutan-2-yl)-N-propylbutane-1-sulfonamide.
| Compound Name | N-(1-amino-2-methylbutan-2-yl)-N-propylbutane-1-sulfonamide |
|---|---|
| PubChem CID | 62009247 |
| Molecular Formula | C12H28N2O2S |
| Molecular Weight | 264.43 g/mol |
| Exact Mass | 264.19 |
| IUPAC Name | N-(1-amino-2-methylbutan-2-yl)-N-propylbutane-1-sulfonamide |
| SMILES | CCCCS(=O)(=O)N(CCC)C(C)(CC)CN |
| InChI | InChI=1S/C12H28N2O2S/c1-5-8-10-17(15,16)14(9-6-2)12(4,7-3)11-13/h5-11,13H2,1-4H3 |
| InChIKey | YQBDEUSCFNLYTG-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.43 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |