C15H32N2O2S — CID 62008250
N-(1-amino-2-methylbutan-2-yl)-1-cyclohexyl-N-propylmethanesulfonamide (PubChem CID 62008250) has the molecular formula C15H32N2O2S and a molecular weight of 304.50 g/mol. Its IUPAC name is N-(1-amino-2-methylbutan-2-yl)-1-cyclohexyl-N-propylmethanesulfonamide.
| Compound Name | N-(1-amino-2-methylbutan-2-yl)-1-cyclohexyl-N-propylmethanesulfonamide |
|---|---|
| PubChem CID | 62008250 |
| Molecular Formula | C15H32N2O2S |
| Molecular Weight | 304.50 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | N-(1-amino-2-methylbutan-2-yl)-1-cyclohexyl-N-propylmethanesulfonamide |
| SMILES | CCCN(C(C)(CC)CN)S(=O)(=O)CC1CCCCC1 |
| InChI | InChI=1S/C15H32N2O2S/c1-4-11-17(15(3,5-2)13-16)20(18,19)12-14-9-7-6-8-10-14/h14H,4-13,16H2,1-3H3 |
| InChIKey | LEOQBEREALKBSK-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.50 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |