C13H27NO3S — CID 79387330
1-cyclohexyl-N-ethyl-N-(2-hydroxy-2-methylpropyl)methanesulfonamide (PubChem CID 79387330) has the molecular formula C13H27NO3S and a molecular weight of 277.43 g/mol. Its IUPAC name is 1-cyclohexyl-N-ethyl-N-(2-hydroxy-2-methylpropyl)methanesulfonamide.
| Compound Name | 1-cyclohexyl-N-ethyl-N-(2-hydroxy-2-methylpropyl)methanesulfonamide |
|---|---|
| PubChem CID | 79387330 |
| Molecular Formula | C13H27NO3S |
| Molecular Weight | 277.43 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | 1-cyclohexyl-N-ethyl-N-(2-hydroxy-2-methylpropyl)methanesulfonamide |
| SMILES | CCN(CC(C)(C)O)S(=O)(=O)CC1CCCCC1 |
| InChI | InChI=1S/C13H27NO3S/c1-4-14(11-13(2,3)15)18(16,17)10-12-8-6-5-7-9-12/h12,15H,4-11H2,1-3H3 |
| InChIKey | SLUFTSNNAKQESC-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.43 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |