C11H22N2O2S — CID 103521132
N-(cyanomethyl)-3,3-dimethyl-N-propylbutane-1-sulfonamide (PubChem CID 103521132) has the molecular formula C11H22N2O2S and a molecular weight of 246.38 g/mol. Its IUPAC name is N-(cyanomethyl)-3,3-dimethyl-N-propylbutane-1-sulfonamide.
| Compound Name | N-(cyanomethyl)-3,3-dimethyl-N-propylbutane-1-sulfonamide |
|---|---|
| PubChem CID | 103521132 |
| Molecular Formula | C11H22N2O2S |
| Molecular Weight | 246.38 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | N-(cyanomethyl)-3,3-dimethyl-N-propylbutane-1-sulfonamide |
| SMILES | CCCN(CC#N)S(=O)(=O)CCC(C)(C)C |
| InChI | InChI=1S/C11H22N2O2S/c1-5-8-13(9-7-12)16(14,15)10-6-11(2,3)4/h5-6,8-10H2,1-4H3 |
| InChIKey | XNPDOHDGVNKSMO-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.38 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|