C4H5F6NO5S2 — CID 162606518
2,2,2-trifluoro-N-hydroxy-N-(2,2,2-trifluoroethylsulfonyl)ethanesulfonamide (PubChem CID 162606518) has the molecular formula C4H5F6NO5S2 and a molecular weight of 325.21 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-hydroxy-N-(2,2,2-trifluoroethylsulfonyl)ethanesulfonamide.
| Compound Name | 2,2,2-trifluoro-N-hydroxy-N-(2,2,2-trifluoroethylsulfonyl)ethanesulfonamide |
|---|---|
| PubChem CID | 162606518 |
| Molecular Formula | C4H5F6NO5S2 |
| Molecular Weight | 325.21 g/mol |
| Exact Mass | 324.95 |
| IUPAC Name | 2,2,2-trifluoro-N-hydroxy-N-(2,2,2-trifluoroethylsulfonyl)ethanesulfonamide |
| SMILES | O=S(=O)(CC(F)(F)F)N(O)S(=O)(=O)CC(F)(F)F |
| InChI | InChI=1S/C4H5F6NO5S2/c5-3(6,7)1-17(13,14)11(12)18(15,16)2-4(8,9)10/h12H,1-2H2 |
| InChIKey | QALVPQCTUHSQDD-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 91.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.21 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|