C3H6F3NO2S — CID 59280662
methanidyl(2,2,2-trifluoroethylsulfonyl)azanium (PubChem CID 59280662) has the molecular formula C3H6F3NO2S and a molecular weight of 177.15 g/mol. Its IUPAC name is methanidyl(2,2,2-trifluoroethylsulfonyl)azanium.
| Compound Name | methanidyl(2,2,2-trifluoroethylsulfonyl)azanium |
|---|---|
| PubChem CID | 59280662 |
| Molecular Formula | C3H6F3NO2S |
| Molecular Weight | 177.15 g/mol |
| Exact Mass | 177.01 |
| IUPAC Name | methanidyl(2,2,2-trifluoroethylsulfonyl)azanium |
| SMILES | [CH2-][NH2+]S(=O)(=O)CC(F)(F)F |
| InChI | InChI=1S/C3H6F3NO2S/c1-7-10(8,9)2-3(4,5)6/h1-2,7H2 |
| InChIKey | WTOXOABMDJIKKS-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 50.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.15 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|