About methanidyl(2,2,2-trifluoroethylsulfonyl)azanium
methanidyl(2,2,2-trifluoroethylsulfonyl)azanium (PubChem CID 59280662) has the molecular formula C3H6F3NO2S
and a molecular weight of 177.15 g/mol. Its IUPAC name is methanidyl(2,2,2-trifluoroethylsulfonyl)azanium.
Molecular Properties
| Compound Name | methanidyl(2,2,2-trifluoroethylsulfonyl)azanium |
| PubChem CID | 59280662 |
| Molecular Formula | C3H6F3NO2S |
| Molecular Weight | 177.15 g/mol |
| Exact Mass | 177.01 |
| IUPAC Name | methanidyl(2,2,2-trifluoroethylsulfonyl)azanium |
| SMILES | [CH2-][NH2+]S(=O)(=O)CC(F)(F)F |
| InChI | InChI=1S/C3H6F3NO2S/c1-7-10(8,9)2-3(4,5)6/h1-2,7H2 |
| InChIKey | WTOXOABMDJIKKS-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 50.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.15 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze methanidyl(2,2,2-trifluoroethylsulfonyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanidyl(2,2,2-trifluoroethylsulfonyl)azanium?
The IUPAC name of methanidyl(2,2,2-trifluoroethylsulfonyl)azanium (CID 59280662) is methanidyl(2,2,2-trifluoroethylsulfonyl)azanium.
What is the SMILES notation for methanidyl(2,2,2-trifluoroethylsulfonyl)azanium?
The canonical SMILES for methanidyl(2,2,2-trifluoroethylsulfonyl)azanium is [CH2-][NH2+]S(=O)(=O)CC(F)(F)F.
What is the InChIKey of methanidyl(2,2,2-trifluoroethylsulfonyl)azanium?
The InChIKey is WTOXOABMDJIKKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6F3NO2S/c1-7-10(8,9)2-3(4,5)6/h1-2,7H2.
What are the key properties of methanidyl(2,2,2-trifluoroethylsulfonyl)azanium?
methanidyl(2,2,2-trifluoroethylsulfonyl)azanium has a molecular weight of 177.15 g/mol, XLogP of -0.77, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methanidyl(2,2,2-trifluoroethylsulfonyl)azanium is sourced from PubChem (CID 59280662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).