C8H12F6O4S2 — CID 158437454
2,3-bis(2,2,2-trifluoroethylsulfonyl)butane (PubChem CID 158437454) has the molecular formula C8H12F6O4S2 and a molecular weight of 350.30 g/mol. Its IUPAC name is 2,3-bis(2,2,2-trifluoroethylsulfonyl)butane.
| Compound Name | 2,3-bis(2,2,2-trifluoroethylsulfonyl)butane |
|---|---|
| PubChem CID | 158437454 |
| Molecular Formula | C8H12F6O4S2 |
| Molecular Weight | 350.30 g/mol |
| Exact Mass | 350.01 |
| IUPAC Name | 2,3-bis(2,2,2-trifluoroethylsulfonyl)butane |
| SMILES | CC(C(C)S(=O)(=O)CC(F)(F)F)S(=O)(=O)CC(F)(F)F |
| InChI | InChI=1S/C8H12F6O4S2/c1-5(19(15,16)3-7(9,10)11)6(2)20(17,18)4-8(12,13)14/h5-6H,3-4H2,1-2H3 |
| InChIKey | HCKFZZNEKIWNCV-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.30 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |