C7H13F3N2O3S — CID 129061059
(2S)-2-amino-5,5,5-trifluoro-4-methyl-N-methylsulfonylpentanamide (PubChem CID 129061059) has the molecular formula C7H13F3N2O3S and a molecular weight of 262.25 g/mol. Its IUPAC name is (2S)-2-amino-5,5,5-trifluoro-4-methyl-N-methylsulfonylpentanamide.
| Compound Name | (2S)-2-amino-5,5,5-trifluoro-4-methyl-N-methylsulfonylpentanamide |
|---|---|
| PubChem CID | 129061059 |
| Molecular Formula | C7H13F3N2O3S |
| Molecular Weight | 262.25 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | (2S)-2-amino-5,5,5-trifluoro-4-methyl-N-methylsulfonylpentanamide |
| SMILES | CC(C[C@H](N)C(=O)NS(C)(=O)=O)C(F)(F)F |
| InChI | InChI=1S/C7H13F3N2O3S/c1-4(7(8,9)10)3-5(11)6(13)12-16(2,14)15/h4-5H,3,11H2,1-2H3,(H,12,13)/t4?,5-/m0/s1 |
| InChIKey | RYXYSKOAVDHBBQ-AKGZTFGVSA-N |
| XLogP | -0.02 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.25 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |