C3H5ClF3NO3S — CID 139547171
chloro N-methyl-N-(2,2,2-trifluoroethyl)sulfamate (PubChem CID 139547171) has the molecular formula C3H5ClF3NO3S and a molecular weight of 227.59 g/mol. Its IUPAC name is chloro N-methyl-N-(2,2,2-trifluoroethyl)sulfamate.
| Compound Name | chloro N-methyl-N-(2,2,2-trifluoroethyl)sulfamate |
|---|---|
| PubChem CID | 139547171 |
| Molecular Formula | C3H5ClF3NO3S |
| Molecular Weight | 227.59 g/mol |
| Exact Mass | 226.96 |
| IUPAC Name | chloro N-methyl-N-(2,2,2-trifluoroethyl)sulfamate |
| SMILES | CN(CC(F)(F)F)S(=O)(=O)OCl |
| InChI | InChI=1S/C3H5ClF3NO3S/c1-8(2-3(5,6)7)12(9,10)11-4/h2H2,1H3 |
| InChIKey | UBJBEJYXFJJGLL-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.59 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |