[ethyl(2,2,2-trifluoroethyl)amino] hydrogen sulfate

C4H8F3NO4S — CID 131724719

IUPAC[ethyl(2,2,2-trifluoroethyl)amino] hydrogen sulfate
SMILESCCN(CC(F)(F)F)OS(=O)(=O)O
InChIInChI=1S/C4H8F3NO4S/c1-2-8(3-4(5,6)7)12-13(9,10)11/h2-3H2,1H3,(H,9,10,11)
InChIKeyKCUWXBOZRVWHJE-UHFFFAOYSA-N
MW223.17 g/mol
LogP0.61
Rot. Bonds4

About [ethyl(2,2,2-trifluoroethyl)amino] hydrogen sulfate

[ethyl(2,2,2-trifluoroethyl)amino] hydrogen sulfate (PubChem CID 131724719) has the molecular formula C4H8F3NO4S and a molecular weight of 223.17 g/mol. Its IUPAC name is [ethyl(2,2,2-trifluoroethyl)amino] hydrogen sulfate.

Molecular Properties

Compound Name[ethyl(2,2,2-trifluoroethyl)amino] hydrogen sulfate
PubChem CID131724719
Molecular FormulaC4H8F3NO4S
Molecular Weight223.17 g/mol
Exact Mass223.01
IUPAC Name[ethyl(2,2,2-trifluoroethyl)amino] hydrogen sulfate
SMILESCCN(CC(F)(F)F)OS(=O)(=O)O
InChIInChI=1S/C4H8F3NO4S/c1-2-8(3-4(5,6)7)12-13(9,10)11/h2-3H2,1H3,(H,9,10,11)
InChIKeyKCUWXBOZRVWHJE-UHFFFAOYSA-N
XLogP0.61
TPSA66.84 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500223.17
LogP ≤ 50.61
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze [ethyl(2,2,2-trifluoroethyl)amino] hydrogen sulfate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

[bis(2-methoxyethyl)amino] hydrogen sulfate;trihydrochloride
CID 173075807
2-[2-[ethyl(2,2,2-trifluoroethyl)amino]acetyl]oxy-1,1-difluoroethanesulfonic acid
CID 118030918
N-pentan-3-yl-N-(2,2,2-trifluoroethyl)methanesulfonamide
CID 64586680
dimethylamino hydrogen sulfate
CID 23081915
sulfuryl dibromide;1,1,1-trifluoropropane
CID 175054852
2-fluorobutan-2-yl hydrogen sulfate
CID 87625275
chloro N-methyl-N-(2,2,2-trifluoroethyl)sulfamate
CID 139547171
potassium;acetyl(2,2,2-trifluoroethyl)sulfamic acid;hydride
CID 173392620
bis(trifluoromethylsulfonyl)azanide;N-ethyl-2,2,2-trifluoro-N-(2-methoxyethyl)ethanamine
CID 157108793
2,2,2-trifluoroethoxymethyl hydrogen sulfate
CID 118676469
tert-butyl 2-[ethyl(2,2,2-trifluoroethyl)amino]propanoate
CID 64686559
3-amino-2-[ethyl(2,2,2-trifluoroethyl)amino]butan-1-ol
CID 64898086

Frequently Asked Questions

What is the IUPAC name of [ethyl(2,2,2-trifluoroethyl)amino] hydrogen sulfate?
The IUPAC name of [ethyl(2,2,2-trifluoroethyl)amino] hydrogen sulfate (CID 131724719) is [ethyl(2,2,2-trifluoroethyl)amino] hydrogen sulfate.
What is the SMILES notation for [ethyl(2,2,2-trifluoroethyl)amino] hydrogen sulfate?
The canonical SMILES for [ethyl(2,2,2-trifluoroethyl)amino] hydrogen sulfate is CCN(CC(F)(F)F)OS(=O)(=O)O.
What is the InChIKey of [ethyl(2,2,2-trifluoroethyl)amino] hydrogen sulfate?
The InChIKey is KCUWXBOZRVWHJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8F3NO4S/c1-2-8(3-4(5,6)7)12-13(9,10)11/h2-3H2,1H3,(H,9,10,11).
What are the key properties of [ethyl(2,2,2-trifluoroethyl)amino] hydrogen sulfate?
[ethyl(2,2,2-trifluoroethyl)amino] hydrogen sulfate has a molecular weight of 223.17 g/mol, XLogP of 0.61, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [ethyl(2,2,2-trifluoroethyl)amino] hydrogen sulfate is sourced from PubChem (CID 131724719), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).