C4H7F3KNO4S — CID 173392620
potassium;acetyl(2,2,2-trifluoroethyl)sulfamic acid;hydride (PubChem CID 173392620) has the molecular formula C4H7F3KNO4S and a molecular weight of 261.26 g/mol. Its IUPAC name is potassium;acetyl(2,2,2-trifluoroethyl)sulfamic acid;hydride.
| Compound Name | potassium;acetyl(2,2,2-trifluoroethyl)sulfamic acid;hydride |
|---|---|
| PubChem CID | 173392620 |
| Molecular Formula | C4H7F3KNO4S |
| Molecular Weight | 261.26 g/mol |
| Exact Mass | 260.97 |
| IUPAC Name | potassium;acetyl(2,2,2-trifluoroethyl)sulfamic acid;hydride |
| SMILES | CC(=O)N(CC(F)(F)F)S(=O)(=O)O.[H-].[K+] |
| InChI | InChI=1S/C4H6F3NO4S.K.H/c1-3(9)8(13(10,11)12)2-4(5,6)7;;/h2H2,1H3,(H,10,11,12);;/q;+1;-1 |
| InChIKey | WVTLPDYKUADKHC-UHFFFAOYSA-N |
| XLogP | -2.68 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.26 |
| LogP ≤ 5 | -2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|