C7H11BrF3NO3S — CID 107492515
N-(2-bromoethyl)-2-methylsulfonyl-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 107492515) has the molecular formula C7H11BrF3NO3S and a molecular weight of 326.13 g/mol. Its IUPAC name is N-(2-bromoethyl)-2-methylsulfonyl-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | N-(2-bromoethyl)-2-methylsulfonyl-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 107492515 |
| Molecular Formula | C7H11BrF3NO3S |
| Molecular Weight | 326.13 g/mol |
| Exact Mass | 324.96 |
| IUPAC Name | N-(2-bromoethyl)-2-methylsulfonyl-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | CS(=O)(=O)CC(=O)N(CCBr)CC(F)(F)F |
| InChI | InChI=1S/C7H11BrF3NO3S/c1-16(14,15)4-6(13)12(3-2-8)5-7(9,10)11/h2-5H2,1H3 |
| InChIKey | CQCCKDAVJNSFHI-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.13 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|