C12H11BrClF4NO — CID 107492455
N-(2-bromoethyl)-2-(2-chloro-6-fluorophenyl)-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 107492455) has the molecular formula C12H11BrClF4NO and a molecular weight of 376.58 g/mol. Its IUPAC name is N-(2-bromoethyl)-2-(2-chloro-6-fluorophenyl)-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | N-(2-bromoethyl)-2-(2-chloro-6-fluorophenyl)-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 107492455 |
| Molecular Formula | C12H11BrClF4NO |
| Molecular Weight | 376.58 g/mol |
| Exact Mass | 374.96 |
| IUPAC Name | N-(2-bromoethyl)-2-(2-chloro-6-fluorophenyl)-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | O=C(Cc1c(F)cccc1Cl)N(CCBr)CC(F)(F)F |
| InChI | InChI=1S/C12H11BrClF4NO/c13-4-5-19(7-12(16,17)18)11(20)6-8-9(14)2-1-3-10(8)15/h1-3H,4-7H2 |
| InChIKey | QMXSFJOFXZBESE-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.58 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|