C12H11BrCl2F3NO — CID 107492483
N-(2-bromoethyl)-2-(3,4-dichlorophenyl)-N-(2,2,2-trifluoroethyl)acetamide (PubChem CID 107492483) has the molecular formula C12H11BrCl2F3NO and a molecular weight of 393.03 g/mol. Its IUPAC name is N-(2-bromoethyl)-2-(3,4-dichlorophenyl)-N-(2,2,2-trifluoroethyl)acetamide.
| Compound Name | N-(2-bromoethyl)-2-(3,4-dichlorophenyl)-N-(2,2,2-trifluoroethyl)acetamide |
|---|---|
| PubChem CID | 107492483 |
| Molecular Formula | C12H11BrCl2F3NO |
| Molecular Weight | 393.03 g/mol |
| Exact Mass | 390.94 |
| IUPAC Name | N-(2-bromoethyl)-2-(3,4-dichlorophenyl)-N-(2,2,2-trifluoroethyl)acetamide |
| SMILES | O=C(Cc1ccc(Cl)c(Cl)c1)N(CCBr)CC(F)(F)F |
| InChI | InChI=1S/C12H11BrCl2F3NO/c13-3-4-19(7-12(16,17)18)11(20)6-8-1-2-9(14)10(15)5-8/h1-2,5H,3-4,6-7H2 |
| InChIKey | FUYFGYJNYLSGPO-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.03 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|