C16H20BrCl2NO — CID 80652853
N-(2-bromoethyl)-N-cyclohexyl-2-(3,4-dichlorophenyl)acetamide (PubChem CID 80652853) has the molecular formula C16H20BrCl2NO and a molecular weight of 393.15 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-cyclohexyl-2-(3,4-dichlorophenyl)acetamide.
| Compound Name | N-(2-bromoethyl)-N-cyclohexyl-2-(3,4-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 80652853 |
| Molecular Formula | C16H20BrCl2NO |
| Molecular Weight | 393.15 g/mol |
| Exact Mass | 391.01 |
| IUPAC Name | N-(2-bromoethyl)-N-cyclohexyl-2-(3,4-dichlorophenyl)acetamide |
| SMILES | O=C(Cc1ccc(Cl)c(Cl)c1)N(CCBr)C1CCCCC1 |
| InChI | InChI=1S/C16H20BrCl2NO/c17-8-9-20(13-4-2-1-3-5-13)16(21)11-12-6-7-14(18)15(19)10-12/h6-7,10,13H,1-5,8-9,11H2 |
| InChIKey | OIXCRDLGYGZJLB-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.15 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|