C9H15BrF3NO — CID 107492479
N-(2-bromoethyl)-2,2-dimethyl-N-(2,2,2-trifluoroethyl)propanamide (PubChem CID 107492479) has the molecular formula C9H15BrF3NO and a molecular weight of 290.12 g/mol. Its IUPAC name is N-(2-bromoethyl)-2,2-dimethyl-N-(2,2,2-trifluoroethyl)propanamide.
| Compound Name | N-(2-bromoethyl)-2,2-dimethyl-N-(2,2,2-trifluoroethyl)propanamide |
|---|---|
| PubChem CID | 107492479 |
| Molecular Formula | C9H15BrF3NO |
| Molecular Weight | 290.12 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | N-(2-bromoethyl)-2,2-dimethyl-N-(2,2,2-trifluoroethyl)propanamide |
| SMILES | CC(C)(C)C(=O)N(CCBr)CC(F)(F)F |
| InChI | InChI=1S/C9H15BrF3NO/c1-8(2,3)7(15)14(5-4-10)6-9(11,12)13/h4-6H2,1-3H3 |
| InChIKey | HAWZJRDQNNXMJQ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.12 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|