C11H19BrF3NO — CID 107492554
N-(2-bromoethyl)-N-(2,2,2-trifluoroethyl)heptanamide (PubChem CID 107492554) has the molecular formula C11H19BrF3NO and a molecular weight of 318.18 g/mol. Its IUPAC name is N-(2-bromoethyl)-N-(2,2,2-trifluoroethyl)heptanamide.
| Compound Name | N-(2-bromoethyl)-N-(2,2,2-trifluoroethyl)heptanamide |
|---|---|
| PubChem CID | 107492554 |
| Molecular Formula | C11H19BrF3NO |
| Molecular Weight | 318.18 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | N-(2-bromoethyl)-N-(2,2,2-trifluoroethyl)heptanamide |
| SMILES | CCCCCCC(=O)N(CCBr)CC(F)(F)F |
| InChI | InChI=1S/C11H19BrF3NO/c1-2-3-4-5-6-10(17)16(8-7-12)9-11(13,14)15/h2-9H2,1H3 |
| InChIKey | KMOWXYMMBCPIRC-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.18 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|