C8H12F3NO4S — CID 55011179
2-[cyclopropyl(2,2,2-trifluoroethyl)sulfamoyl]propanoic acid (PubChem CID 55011179) has the molecular formula C8H12F3NO4S and a molecular weight of 275.25 g/mol. Its IUPAC name is 2-[cyclopropyl(2,2,2-trifluoroethyl)sulfamoyl]propanoic acid.
| Compound Name | 2-[cyclopropyl(2,2,2-trifluoroethyl)sulfamoyl]propanoic acid |
|---|---|
| PubChem CID | 55011179 |
| Molecular Formula | C8H12F3NO4S |
| Molecular Weight | 275.25 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | 2-[cyclopropyl(2,2,2-trifluoroethyl)sulfamoyl]propanoic acid |
| SMILES | CC(C(=O)O)S(=O)(=O)N(CC(F)(F)F)C1CC1 |
| InChI | InChI=1S/C8H12F3NO4S/c1-5(7(13)14)17(15,16)12(6-2-3-6)4-8(9,10)11/h5-6H,2-4H2,1H3,(H,13,14) |
| InChIKey | HOVFSSWWKWHPTK-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.25 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |