2-[cyclopropyl(2,2,2-trifluoroethyl)sulfamoyl]propanoic acid

C8H12F3NO4S — CID 55011179

IUPAC2-[cyclopropyl(2,2,2-trifluoroethyl)sulfamoyl]propanoic acid
SMILESCC(C(=O)O)S(=O)(=O)N(CC(F)(F)F)C1CC1
InChIInChI=1S/C8H12F3NO4S/c1-5(7(13)14)17(15,16)12(6-2-3-6)4-8(9,10)11/h5-6H,2-4H2,1H3,(H,13,14)
InChIKeyHOVFSSWWKWHPTK-UHFFFAOYSA-N
MW275.25 g/mol
LogP0.82
Rot. Bonds5

About 2-[cyclopropyl(2,2,2-trifluoroethyl)sulfamoyl]propanoic acid

2-[cyclopropyl(2,2,2-trifluoroethyl)sulfamoyl]propanoic acid (PubChem CID 55011179) has the molecular formula C8H12F3NO4S and a molecular weight of 275.25 g/mol. Its IUPAC name is 2-[cyclopropyl(2,2,2-trifluoroethyl)sulfamoyl]propanoic acid.

Molecular Properties

Compound Name2-[cyclopropyl(2,2,2-trifluoroethyl)sulfamoyl]propanoic acid
PubChem CID55011179
Molecular FormulaC8H12F3NO4S
Molecular Weight275.25 g/mol
Exact Mass275.04
IUPAC Name2-[cyclopropyl(2,2,2-trifluoroethyl)sulfamoyl]propanoic acid
SMILESCC(C(=O)O)S(=O)(=O)N(CC(F)(F)F)C1CC1
InChIInChI=1S/C8H12F3NO4S/c1-5(7(13)14)17(15,16)12(6-2-3-6)4-8(9,10)11/h5-6H,2-4H2,1H3,(H,13,14)
InChIKeyHOVFSSWWKWHPTK-UHFFFAOYSA-N
XLogP0.82
TPSA74.68 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500275.25
LogP ≤ 50.82
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-[cyclopropyl(2,2,2-trifluoroethyl)sulfamoyl]propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[cyclopropyl(2,2,2-trifluoroethyl)sulfamoyl]propanoic acid?
The IUPAC name of 2-[cyclopropyl(2,2,2-trifluoroethyl)sulfamoyl]propanoic acid (CID 55011179) is 2-[cyclopropyl(2,2,2-trifluoroethyl)sulfamoyl]propanoic acid.
What is the SMILES notation for 2-[cyclopropyl(2,2,2-trifluoroethyl)sulfamoyl]propanoic acid?
The canonical SMILES for 2-[cyclopropyl(2,2,2-trifluoroethyl)sulfamoyl]propanoic acid is CC(C(=O)O)S(=O)(=O)N(CC(F)(F)F)C1CC1.
What is the InChIKey of 2-[cyclopropyl(2,2,2-trifluoroethyl)sulfamoyl]propanoic acid?
The InChIKey is HOVFSSWWKWHPTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12F3NO4S/c1-5(7(13)14)17(15,16)12(6-2-3-6)4-8(9,10)11/h5-6H,2-4H2,1H3,(H,13,14).
What are the key properties of 2-[cyclopropyl(2,2,2-trifluoroethyl)sulfamoyl]propanoic acid?
2-[cyclopropyl(2,2,2-trifluoroethyl)sulfamoyl]propanoic acid has a molecular weight of 275.25 g/mol, XLogP of 0.82, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[cyclopropyl(2,2,2-trifluoroethyl)sulfamoyl]propanoic acid is sourced from PubChem (CID 55011179), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).