C9H16F3NO3S — CID 90554867
N-(oxan-4-yl)-N-(2,2,2-trifluoroethyl)ethanesulfonamide (PubChem CID 90554867) has the molecular formula C9H16F3NO3S and a molecular weight of 275.29 g/mol. Its IUPAC name is N-(oxan-4-yl)-N-(2,2,2-trifluoroethyl)ethanesulfonamide.
| Compound Name | N-(oxan-4-yl)-N-(2,2,2-trifluoroethyl)ethanesulfonamide |
|---|---|
| PubChem CID | 90554867 |
| Molecular Formula | C9H16F3NO3S |
| Molecular Weight | 275.29 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | N-(oxan-4-yl)-N-(2,2,2-trifluoroethyl)ethanesulfonamide |
| SMILES | CCS(=O)(=O)N(CC(F)(F)F)C1CCOCC1 |
| InChI | InChI=1S/C9H16F3NO3S/c1-2-17(14,15)13(7-9(10,11)12)8-3-5-16-6-4-8/h8H,2-7H2,1H3 |
| InChIKey | LLQLIJKKJGILIE-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.29 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |