C11H14F3NO3S2 — CID 90554881
N-(oxan-4-yl)-N-(2,2,2-trifluoroethyl)thiophene-2-sulfonamide (PubChem CID 90554881) has the molecular formula C11H14F3NO3S2 and a molecular weight of 329.37 g/mol. Its IUPAC name is N-(oxan-4-yl)-N-(2,2,2-trifluoroethyl)thiophene-2-sulfonamide.
| Compound Name | N-(oxan-4-yl)-N-(2,2,2-trifluoroethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 90554881 |
| Molecular Formula | C11H14F3NO3S2 |
| Molecular Weight | 329.37 g/mol |
| Exact Mass | 329.04 |
| IUPAC Name | N-(oxan-4-yl)-N-(2,2,2-trifluoroethyl)thiophene-2-sulfonamide |
| SMILES | O=S(=O)(c1cccs1)N(CC(F)(F)F)C1CCOCC1 |
| InChI | InChI=1S/C11H14F3NO3S2/c12-11(13,14)8-15(9-3-5-18-6-4-9)20(16,17)10-2-1-7-19-10/h1-2,7,9H,3-6,8H2 |
| InChIKey | SYRZFHODBIQXOB-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.37 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |