C15H19NO3S3 — CID 90610868
5-methyl-N-(oxan-4-yl)-N-(thiophen-2-ylmethyl)thiophene-2-sulfonamide (PubChem CID 90610868) has the molecular formula C15H19NO3S3 and a molecular weight of 357.52 g/mol. Its IUPAC name is 5-methyl-N-(oxan-4-yl)-N-(thiophen-2-ylmethyl)thiophene-2-sulfonamide.
| Compound Name | 5-methyl-N-(oxan-4-yl)-N-(thiophen-2-ylmethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 90610868 |
| Molecular Formula | C15H19NO3S3 |
| Molecular Weight | 357.52 g/mol |
| Exact Mass | 357.05 |
| IUPAC Name | 5-methyl-N-(oxan-4-yl)-N-(thiophen-2-ylmethyl)thiophene-2-sulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(Cc2cccs2)C2CCOCC2)s1 |
| InChI | InChI=1S/C15H19NO3S3/c1-12-4-5-15(21-12)22(17,18)16(11-14-3-2-10-20-14)13-6-8-19-9-7-13/h2-5,10,13H,6-9,11H2,1H3 |
| InChIKey | WGJRHCFTKGHBLO-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.52 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |