C11H17NO2S2 — CID 61383748
N-cyclopropyl-N-(thiophen-2-ylmethyl)propane-1-sulfonamide (PubChem CID 61383748) has the molecular formula C11H17NO2S2 and a molecular weight of 259.40 g/mol. Its IUPAC name is N-cyclopropyl-N-(thiophen-2-ylmethyl)propane-1-sulfonamide.
| Compound Name | N-cyclopropyl-N-(thiophen-2-ylmethyl)propane-1-sulfonamide |
|---|---|
| PubChem CID | 61383748 |
| Molecular Formula | C11H17NO2S2 |
| Molecular Weight | 259.40 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | N-cyclopropyl-N-(thiophen-2-ylmethyl)propane-1-sulfonamide |
| SMILES | CCCS(=O)(=O)N(Cc1cccs1)C1CC1 |
| InChI | InChI=1S/C11H17NO2S2/c1-2-8-16(13,14)12(10-5-6-10)9-11-4-3-7-15-11/h3-4,7,10H,2,5-6,8-9H2,1H3 |
| InChIKey | UUMJAUZFRGNTNC-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.40 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |