C14H18N2O2S3 — CID 102752582
2-(aminomethyl)-N-cyclopropyl-4-methyl-N-(thiophen-2-ylmethyl)thiophene-3-sulfonamide (PubChem CID 102752582) has the molecular formula C14H18N2O2S3 and a molecular weight of 342.51 g/mol. Its IUPAC name is 2-(aminomethyl)-N-cyclopropyl-4-methyl-N-(thiophen-2-ylmethyl)thiophene-3-sulfonamide.
| Compound Name | 2-(aminomethyl)-N-cyclopropyl-4-methyl-N-(thiophen-2-ylmethyl)thiophene-3-sulfonamide |
|---|---|
| PubChem CID | 102752582 |
| Molecular Formula | C14H18N2O2S3 |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | 2-(aminomethyl)-N-cyclopropyl-4-methyl-N-(thiophen-2-ylmethyl)thiophene-3-sulfonamide |
| SMILES | Cc1csc(CN)c1S(=O)(=O)N(Cc1cccs1)C1CC1 |
| InChI | InChI=1S/C14H18N2O2S3/c1-10-9-20-13(7-15)14(10)21(17,18)16(11-4-5-11)8-12-3-2-6-19-12/h2-3,6,9,11H,4-5,7-8,15H2,1H3 |
| InChIKey | IKFNIOOBVJVLJU-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |