C13H18N4O2S2 — CID 61111603
3-amino-N-cyclopropyl-1-ethyl-N-(thiophen-2-ylmethyl)pyrazole-4-sulfonamide (PubChem CID 61111603) has the molecular formula C13H18N4O2S2 and a molecular weight of 326.45 g/mol. Its IUPAC name is 3-amino-N-cyclopropyl-1-ethyl-N-(thiophen-2-ylmethyl)pyrazole-4-sulfonamide.
| Compound Name | 3-amino-N-cyclopropyl-1-ethyl-N-(thiophen-2-ylmethyl)pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 61111603 |
| Molecular Formula | C13H18N4O2S2 |
| Molecular Weight | 326.45 g/mol |
| Exact Mass | 326.09 |
| IUPAC Name | 3-amino-N-cyclopropyl-1-ethyl-N-(thiophen-2-ylmethyl)pyrazole-4-sulfonamide |
| SMILES | CCn1cc(S(=O)(=O)N(Cc2cccs2)C2CC2)c(N)n1 |
| InChI | InChI=1S/C13H18N4O2S2/c1-2-16-9-12(13(14)15-16)21(18,19)17(10-5-6-10)8-11-4-3-7-20-11/h3-4,7,9-10H,2,5-6,8H2,1H3,(H2,14,15) |
| InChIKey | SZMDRZJCHGLMHA-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 81.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.45 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |