C18H23NO4S2 — CID 90610877
2-ethoxy-N-(oxan-4-yl)-N-(thiophen-2-ylmethyl)benzenesulfonamide (PubChem CID 90610877) has the molecular formula C18H23NO4S2 and a molecular weight of 381.52 g/mol. Its IUPAC name is 2-ethoxy-N-(oxan-4-yl)-N-(thiophen-2-ylmethyl)benzenesulfonamide.
| Compound Name | 2-ethoxy-N-(oxan-4-yl)-N-(thiophen-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 90610877 |
| Molecular Formula | C18H23NO4S2 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | 2-ethoxy-N-(oxan-4-yl)-N-(thiophen-2-ylmethyl)benzenesulfonamide |
| SMILES | CCOc1ccccc1S(=O)(=O)N(Cc1cccs1)C1CCOCC1 |
| InChI | InChI=1S/C18H23NO4S2/c1-2-23-17-7-3-4-8-18(17)25(20,21)19(14-16-6-5-13-24-16)15-9-11-22-12-10-15/h3-8,13,15H,2,9-12,14H2,1H3 |
| InChIKey | FRNGIGLHOSVGPA-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |