C16H18ClNO3S2 — CID 90610883
3-chloro-N-(oxan-4-yl)-N-(thiophen-2-ylmethyl)benzenesulfonamide (PubChem CID 90610883) has the molecular formula C16H18ClNO3S2 and a molecular weight of 371.91 g/mol. Its IUPAC name is 3-chloro-N-(oxan-4-yl)-N-(thiophen-2-ylmethyl)benzenesulfonamide.
| Compound Name | 3-chloro-N-(oxan-4-yl)-N-(thiophen-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 90610883 |
| Molecular Formula | C16H18ClNO3S2 |
| Molecular Weight | 371.91 g/mol |
| Exact Mass | 371.04 |
| IUPAC Name | 3-chloro-N-(oxan-4-yl)-N-(thiophen-2-ylmethyl)benzenesulfonamide |
| SMILES | O=S(=O)(c1cccc(Cl)c1)N(Cc1cccs1)C1CCOCC1 |
| InChI | InChI=1S/C16H18ClNO3S2/c17-13-3-1-5-16(11-13)23(19,20)18(12-15-4-2-10-22-15)14-6-8-21-9-7-14/h1-5,10-11,14H,6-9,12H2 |
| InChIKey | NTQWSOBHCZLIRR-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.91 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |