C16H18ClNO2S2 — CID 90496128
1-(3-chlorophenyl)-N-cyclopropyl-N-(2-thiophen-2-ylethyl)methanesulfonamide (PubChem CID 90496128) has the molecular formula C16H18ClNO2S2 and a molecular weight of 355.91 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-N-cyclopropyl-N-(2-thiophen-2-ylethyl)methanesulfonamide.
| Compound Name | 1-(3-chlorophenyl)-N-cyclopropyl-N-(2-thiophen-2-ylethyl)methanesulfonamide |
|---|---|
| PubChem CID | 90496128 |
| Molecular Formula | C16H18ClNO2S2 |
| Molecular Weight | 355.91 g/mol |
| Exact Mass | 355.05 |
| IUPAC Name | 1-(3-chlorophenyl)-N-cyclopropyl-N-(2-thiophen-2-ylethyl)methanesulfonamide |
| SMILES | O=S(=O)(Cc1cccc(Cl)c1)N(CCc1cccs1)C1CC1 |
| InChI | InChI=1S/C16H18ClNO2S2/c17-14-4-1-3-13(11-14)12-22(19,20)18(15-6-7-15)9-8-16-5-2-10-21-16/h1-5,10-11,15H,6-9,12H2 |
| InChIKey | PBDHNICPXBPBKU-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.91 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |