C11H19F3N2O2S — CID 107488158
4,4,4-trifluoro-N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]butane-1-sulfonamide (PubChem CID 107488158) has the molecular formula C11H19F3N2O2S and a molecular weight of 300.35 g/mol. Its IUPAC name is 4,4,4-trifluoro-N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]butane-1-sulfonamide.
| Compound Name | 4,4,4-trifluoro-N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 107488158 |
| Molecular Formula | C11H19F3N2O2S |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 4,4,4-trifluoro-N-[2-(1,2,3,6-tetrahydropyridin-4-yl)ethyl]butane-1-sulfonamide |
| SMILES | O=S(=O)(CCCC(F)(F)F)NCCC1=CCNCC1 |
| InChI | InChI=1S/C11H19F3N2O2S/c12-11(13,14)5-1-9-19(17,18)16-8-4-10-2-6-15-7-3-10/h2,15-16H,1,3-9H2 |
| InChIKey | YBOUBXHPEKAMKH-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|