C12H19F3N2O2S — CID 114490308
1-(piperidin-4-ylmethylsulfonyl)-4-(trifluoromethyl)-3,6-dihydro-2H-pyridine (PubChem CID 114490308) has the molecular formula C12H19F3N2O2S and a molecular weight of 312.36 g/mol. Its IUPAC name is 1-(piperidin-4-ylmethylsulfonyl)-4-(trifluoromethyl)-3,6-dihydro-2H-pyridine.
| Compound Name | 1-(piperidin-4-ylmethylsulfonyl)-4-(trifluoromethyl)-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 114490308 |
| Molecular Formula | C12H19F3N2O2S |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 1-(piperidin-4-ylmethylsulfonyl)-4-(trifluoromethyl)-3,6-dihydro-2H-pyridine |
| SMILES | O=S(=O)(CC1CCNCC1)N1CC=C(C(F)(F)F)CC1 |
| InChI | InChI=1S/C12H19F3N2O2S/c13-12(14,15)11-3-7-17(8-4-11)20(18,19)9-10-1-5-16-6-2-10/h3,10,16H,1-2,4-9H2 |
| InChIKey | BDICCSMTHZGEQJ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|