C12H21FN2O2S — CID 143465958
(4-fluoro-6-piperidin-1-ylsulfonylcyclohex-2-en-1-yl)methanamine (PubChem CID 143465958) has the molecular formula C12H21FN2O2S and a molecular weight of 276.38 g/mol. Its IUPAC name is (4-fluoro-6-piperidin-1-ylsulfonylcyclohex-2-en-1-yl)methanamine.
| Compound Name | (4-fluoro-6-piperidin-1-ylsulfonylcyclohex-2-en-1-yl)methanamine |
|---|---|
| PubChem CID | 143465958 |
| Molecular Formula | C12H21FN2O2S |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | (4-fluoro-6-piperidin-1-ylsulfonylcyclohex-2-en-1-yl)methanamine |
| SMILES | NCC1C=CC(F)CC1S(=O)(=O)N1CCCCC1 |
| InChI | InChI=1S/C12H21FN2O2S/c13-11-5-4-10(9-14)12(8-11)18(16,17)15-6-2-1-3-7-15/h4-5,10-12H,1-3,6-9,14H2 |
| InChIKey | PMPFAWPPCSVGKB-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|