C14H24F2N2O2S — CID 97326166
N-[[(1S)-cyclohex-3-en-1-yl]methyl]-1-[1-(difluoromethylsulfonyl)piperidin-4-yl]methanamine (PubChem CID 97326166) has the molecular formula C14H24F2N2O2S and a molecular weight of 322.42 g/mol. Its IUPAC name is N-[[(1S)-cyclohex-3-en-1-yl]methyl]-1-[1-(difluoromethylsulfonyl)piperidin-4-yl]methanamine.
| Compound Name | N-[[(1S)-cyclohex-3-en-1-yl]methyl]-1-[1-(difluoromethylsulfonyl)piperidin-4-yl]methanamine |
|---|---|
| PubChem CID | 97326166 |
| Molecular Formula | C14H24F2N2O2S |
| Molecular Weight | 322.42 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | N-[[(1S)-cyclohex-3-en-1-yl]methyl]-1-[1-(difluoromethylsulfonyl)piperidin-4-yl]methanamine |
| SMILES | O=S(=O)(C(F)F)N1CCC(CNC[C@@H]2CC=CCC2)CC1 |
| InChI | InChI=1S/C14H24F2N2O2S/c15-14(16)21(19,20)18-8-6-13(7-9-18)11-17-10-12-4-2-1-3-5-12/h1-2,12-14,17H,3-11H2/t12-/m1/s1 |
| InChIKey | MPINJACSSUTOIG-GFCCVEGCSA-N |
| XLogP | 2.20 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.42 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|