C12H17F3N2O2S — CID 69115799
6-piperidin-4-yl-6-(trifluoromethyl)cyclohexa-2,4-diene-1-sulfonamide (PubChem CID 69115799) has the molecular formula C12H17F3N2O2S and a molecular weight of 310.34 g/mol. Its IUPAC name is 6-piperidin-4-yl-6-(trifluoromethyl)cyclohexa-2,4-diene-1-sulfonamide.
| Compound Name | 6-piperidin-4-yl-6-(trifluoromethyl)cyclohexa-2,4-diene-1-sulfonamide |
|---|---|
| PubChem CID | 69115799 |
| Molecular Formula | C12H17F3N2O2S |
| Molecular Weight | 310.34 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 6-piperidin-4-yl-6-(trifluoromethyl)cyclohexa-2,4-diene-1-sulfonamide |
| SMILES | NS(=O)(=O)C1C=CC=CC1(C1CCNCC1)C(F)(F)F |
| InChI | InChI=1S/C12H17F3N2O2S/c13-12(14,15)11(9-4-7-17-8-5-9)6-2-1-3-10(11)20(16,18)19/h1-3,6,9-10,17H,4-5,7-8H2,(H2,16,18,19) |
| InChIKey | ZFBVGYSZFNAEQZ-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.34 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |