C13H21F3N2O2S — CID 97240146
N-[[(1S)-cyclohex-3-en-1-yl]methyl]-1-(trifluoromethylsulfonyl)piperidin-4-amine (PubChem CID 97240146) has the molecular formula C13H21F3N2O2S and a molecular weight of 326.38 g/mol. Its IUPAC name is N-[[(1S)-cyclohex-3-en-1-yl]methyl]-1-(trifluoromethylsulfonyl)piperidin-4-amine.
| Compound Name | N-[[(1S)-cyclohex-3-en-1-yl]methyl]-1-(trifluoromethylsulfonyl)piperidin-4-amine |
|---|---|
| PubChem CID | 97240146 |
| Molecular Formula | C13H21F3N2O2S |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | N-[[(1S)-cyclohex-3-en-1-yl]methyl]-1-(trifluoromethylsulfonyl)piperidin-4-amine |
| SMILES | O=S(=O)(N1CCC(NC[C@@H]2CC=CCC2)CC1)C(F)(F)F |
| InChI | InChI=1S/C13H21F3N2O2S/c14-13(15,16)21(19,20)18-8-6-12(7-9-18)17-10-11-4-2-1-3-5-11/h1-2,11-12,17H,3-10H2/t11-/m1/s1 |
| InChIKey | AHAREYPYEZSTGI-LLVKDONJSA-N |
| XLogP | 2.25 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|