C15H18N2O5S — CID 94189662
(2S)-N-[2-(1,3-dioxoisoindol-2-yl)ethylsulfonyl]-2-methylbutanamide (PubChem CID 94189662) has the molecular formula C15H18N2O5S and a molecular weight of 338.39 g/mol. Its IUPAC name is (2S)-N-[2-(1,3-dioxoisoindol-2-yl)ethylsulfonyl]-2-methylbutanamide.
| Compound Name | (2S)-N-[2-(1,3-dioxoisoindol-2-yl)ethylsulfonyl]-2-methylbutanamide |
|---|---|
| PubChem CID | 94189662 |
| Molecular Formula | C15H18N2O5S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | (2S)-N-[2-(1,3-dioxoisoindol-2-yl)ethylsulfonyl]-2-methylbutanamide |
| SMILES | CC[C@H](C)C(=O)NS(=O)(=O)CCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C15H18N2O5S/c1-3-10(2)13(18)16-23(21,22)9-8-17-14(19)11-6-4-5-7-12(11)15(17)20/h4-7,10H,3,8-9H2,1-2H3,(H,16,18)/t10-/m0/s1 |
| InChIKey | URRQZGLDVXEGDF-JTQLQIEISA-N |
| XLogP | 0.77 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|