C14H14N2O5 — CID 53215786
3-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]-2-methylpropanoic acid (PubChem CID 53215786) has the molecular formula C14H14N2O5 and a molecular weight of 290.28 g/mol. Its IUPAC name is 3-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]-2-methylpropanoic acid.
| Compound Name | 3-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 53215786 |
| Molecular Formula | C14H14N2O5 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 3-[[2-(1,3-dioxoisoindol-2-yl)acetyl]amino]-2-methylpropanoic acid |
| SMILES | CC(CNC(=O)CN1C(=O)c2ccccc2C1=O)C(=O)O |
| InChI | InChI=1S/C14H14N2O5/c1-8(14(20)21)6-15-11(17)7-16-12(18)9-4-2-3-5-10(9)13(16)19/h2-5,8H,6-7H2,1H3,(H,15,17)(H,20,21) |
| InChIKey | YMTIBHNTBAUBOC-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|