C22H24N3O3+ — CID 8798907
2-(1,3-dioxoisoindol-2-yl)-N-[(2R)-2-phenyl-2-pyrrolidin-1-ium-1-ylethyl]acetamide (PubChem CID 8798907) has the molecular formula C22H24N3O3+ and a molecular weight of 378.45 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-[(2R)-2-phenyl-2-pyrrolidin-1-ium-1-ylethyl]acetamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-[(2R)-2-phenyl-2-pyrrolidin-1-ium-1-ylethyl]acetamide |
|---|---|
| PubChem CID | 8798907 |
| Molecular Formula | C22H24N3O3+ |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-[(2R)-2-phenyl-2-pyrrolidin-1-ium-1-ylethyl]acetamide |
| SMILES | O=C(CN1C(=O)c2ccccc2C1=O)NC[C@@H](c1ccccc1)[NH+]1CCCC1 |
| InChI | InChI=1S/C22H23N3O3/c26-20(15-25-21(27)17-10-4-5-11-18(17)22(25)28)23-14-19(24-12-6-7-13-24)16-8-2-1-3-9-16/h1-5,8-11,19H,6-7,12-15H2,(H,23,26)/p+1/t19-/m0/s1 |
| InChIKey | VDPWFVQDMMAFOA-IBGZPJMESA-O |
| XLogP | 0.82 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|