C23H26N3O3+ — CID 8798719
3-(1,3-dioxoisoindol-2-yl)-N-[(2R)-2-phenyl-2-pyrrolidin-1-ium-1-ylethyl]propanamide (PubChem CID 8798719) has the molecular formula C23H26N3O3+ and a molecular weight of 392.48 g/mol. Its IUPAC name is 3-(1,3-dioxoisoindol-2-yl)-N-[(2R)-2-phenyl-2-pyrrolidin-1-ium-1-ylethyl]propanamide.
| Compound Name | 3-(1,3-dioxoisoindol-2-yl)-N-[(2R)-2-phenyl-2-pyrrolidin-1-ium-1-ylethyl]propanamide |
|---|---|
| PubChem CID | 8798719 |
| Molecular Formula | C23H26N3O3+ |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | 3-(1,3-dioxoisoindol-2-yl)-N-[(2R)-2-phenyl-2-pyrrolidin-1-ium-1-ylethyl]propanamide |
| SMILES | O=C(CCN1C(=O)c2ccccc2C1=O)NC[C@@H](c1ccccc1)[NH+]1CCCC1 |
| InChI | InChI=1S/C23H25N3O3/c27-21(12-15-26-22(28)18-10-4-5-11-19(18)23(26)29)24-16-20(25-13-6-7-14-25)17-8-2-1-3-9-17/h1-5,8-11,20H,6-7,12-16H2,(H,24,27)/p+1/t20-/m0/s1 |
| InChIKey | FFZBDUHPYQRMBS-FQEVSTJZSA-O |
| XLogP | 1.21 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|