C17H17N5O5S — CID 56583547
6-(dimethylamino)-N-[2-(1,3-dioxoisoindol-2-yl)ethylsulfonyl]pyridazine-3-carboxamide (PubChem CID 56583547) has the molecular formula C17H17N5O5S and a molecular weight of 403.42 g/mol. Its IUPAC name is 6-(dimethylamino)-N-[2-(1,3-dioxoisoindol-2-yl)ethylsulfonyl]pyridazine-3-carboxamide.
| Compound Name | 6-(dimethylamino)-N-[2-(1,3-dioxoisoindol-2-yl)ethylsulfonyl]pyridazine-3-carboxamide |
|---|---|
| PubChem CID | 56583547 |
| Molecular Formula | C17H17N5O5S |
| Molecular Weight | 403.42 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | 6-(dimethylamino)-N-[2-(1,3-dioxoisoindol-2-yl)ethylsulfonyl]pyridazine-3-carboxamide |
| SMILES | CN(C)c1ccc(C(=O)NS(=O)(=O)CCN2C(=O)c3ccccc3C2=O)nn1 |
| InChI | InChI=1S/C17H17N5O5S/c1-21(2)14-8-7-13(18-19-14)15(23)20-28(26,27)10-9-22-16(24)11-5-3-4-6-12(11)17(22)25/h3-8H,9-10H2,1-2H3,(H,20,23) |
| InChIKey | JEDLYSUQQYXTSQ-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 129.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.42 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|