C17H21N3O5S — CID 110312688
2-(1,3-dioxoisoindol-2-yl)-N-(2-oxo-2-piperidin-1-ylethyl)ethanesulfonamide (PubChem CID 110312688) has the molecular formula C17H21N3O5S and a molecular weight of 379.44 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)-N-(2-oxo-2-piperidin-1-ylethyl)ethanesulfonamide.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)-N-(2-oxo-2-piperidin-1-ylethyl)ethanesulfonamide |
|---|---|
| PubChem CID | 110312688 |
| Molecular Formula | C17H21N3O5S |
| Molecular Weight | 379.44 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)-N-(2-oxo-2-piperidin-1-ylethyl)ethanesulfonamide |
| SMILES | O=C(CNS(=O)(=O)CCN1C(=O)c2ccccc2C1=O)N1CCCCC1 |
| InChI | InChI=1S/C17H21N3O5S/c21-15(19-8-4-1-5-9-19)12-18-26(24,25)11-10-20-16(22)13-6-2-3-7-14(13)17(20)23/h2-3,6-7,18H,1,4-5,8-12H2 |
| InChIKey | FVLCIEGLJVDESJ-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 103.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.44 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|