C19H18N2O5S — CID 55758157
N-[2-(1,3-dioxoisoindol-2-yl)ethylsulfonyl]-2-(2-methylphenyl)acetamide (PubChem CID 55758157) has the molecular formula C19H18N2O5S and a molecular weight of 386.43 g/mol. Its IUPAC name is N-[2-(1,3-dioxoisoindol-2-yl)ethylsulfonyl]-2-(2-methylphenyl)acetamide.
| Compound Name | N-[2-(1,3-dioxoisoindol-2-yl)ethylsulfonyl]-2-(2-methylphenyl)acetamide |
|---|---|
| PubChem CID | 55758157 |
| Molecular Formula | C19H18N2O5S |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | N-[2-(1,3-dioxoisoindol-2-yl)ethylsulfonyl]-2-(2-methylphenyl)acetamide |
| SMILES | Cc1ccccc1CC(=O)NS(=O)(=O)CCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C19H18N2O5S/c1-13-6-2-3-7-14(13)12-17(22)20-27(25,26)11-10-21-18(23)15-8-4-5-9-16(15)19(21)24/h2-9H,10-12H2,1H3,(H,20,22) |
| InChIKey | UTPYAPPCWADEPC-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|