C17H20N2O7S — CID 108755168
2-[3-(1,3-dioxoisoindol-2-yl)propanoylamino]-4-ethylsulfonylbutanoic acid (PubChem CID 108755168) has the molecular formula C17H20N2O7S and a molecular weight of 396.42 g/mol. Its IUPAC name is 2-[3-(1,3-dioxoisoindol-2-yl)propanoylamino]-4-ethylsulfonylbutanoic acid.
| Compound Name | 2-[3-(1,3-dioxoisoindol-2-yl)propanoylamino]-4-ethylsulfonylbutanoic acid |
|---|---|
| PubChem CID | 108755168 |
| Molecular Formula | C17H20N2O7S |
| Molecular Weight | 396.42 g/mol |
| Exact Mass | 396.10 |
| IUPAC Name | 2-[3-(1,3-dioxoisoindol-2-yl)propanoylamino]-4-ethylsulfonylbutanoic acid |
| SMILES | CCS(=O)(=O)CCC(NC(=O)CCN1C(=O)c2ccccc2C1=O)C(=O)O |
| InChI | InChI=1S/C17H20N2O7S/c1-2-27(25,26)10-8-13(17(23)24)18-14(20)7-9-19-15(21)11-5-3-4-6-12(11)16(19)22/h3-6,13H,2,7-10H2,1H3,(H,18,20)(H,23,24) |
| InChIKey | ZSODNQAKIPGWFK-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 137.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.42 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|