C20H25N3O9S — CID 108731640
4-ethylsulfonyl-2-[6-(4-nitro-1,3-dioxoisoindol-2-yl)hexanoylamino]butanoic acid (PubChem CID 108731640) has the molecular formula C20H25N3O9S and a molecular weight of 483.50 g/mol. Its IUPAC name is 4-ethylsulfonyl-2-[6-(4-nitro-1,3-dioxoisoindol-2-yl)hexanoylamino]butanoic acid.
| Compound Name | 4-ethylsulfonyl-2-[6-(4-nitro-1,3-dioxoisoindol-2-yl)hexanoylamino]butanoic acid |
|---|---|
| PubChem CID | 108731640 |
| Molecular Formula | C20H25N3O9S |
| Molecular Weight | 483.50 g/mol |
| Exact Mass | 483.13 |
| IUPAC Name | 4-ethylsulfonyl-2-[6-(4-nitro-1,3-dioxoisoindol-2-yl)hexanoylamino]butanoic acid |
| SMILES | CCS(=O)(=O)CCC(NC(=O)CCCCCN1C(=O)c2cccc([N+](=O)[O-])c2C1=O)C(=O)O |
| InChI | InChI=1S/C20H25N3O9S/c1-2-33(31,32)12-10-14(20(27)28)21-16(24)9-4-3-5-11-22-18(25)13-7-6-8-15(23(29)30)17(13)19(22)26/h6-8,14H,2-5,9-12H2,1H3,(H,21,24)(H,27,28) |
| InChIKey | BESWPVBRLSHIJS-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 181.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.50 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|