C24H40N8O4S2 — CID 158558609
2-amino-N-(1-pyridin-4-ylpiperidin-4-yl)ethanesulfonamide (PubChem CID 158558609) has the molecular formula C24H40N8O4S2 and a molecular weight of 568.77 g/mol. Its IUPAC name is 2-amino-N-(1-pyridin-4-ylpiperidin-4-yl)ethanesulfonamide.
| Compound Name | 2-amino-N-(1-pyridin-4-ylpiperidin-4-yl)ethanesulfonamide |
|---|---|
| PubChem CID | 158558609 |
| Molecular Formula | C24H40N8O4S2 |
| Molecular Weight | 568.77 g/mol |
| Exact Mass | 568.26 |
| IUPAC Name | 2-amino-N-(1-pyridin-4-ylpiperidin-4-yl)ethanesulfonamide |
| SMILES | NCCS(=O)(=O)NC1CCN(c2ccncc2)CC1.NCCS(=O)(=O)NC1CCN(c2ccncc2)CC1 |
| InChI | InChI=1S/2C12H20N4O2S/c2*13-5-10-19(17,18)15-11-3-8-16(9-4-11)12-1-6-14-7-2-12/h2*1-2,6-7,11,15H,3-5,8-10,13H2 |
| InChIKey | HQPHPIAYIDRLAY-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 176.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.77 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |