C18H24N4O2 — CID 110956996
1-cyclohexyl-3-[2-(1,3-dioxoisoindol-2-yl)ethyl]-2-methylguanidine (PubChem CID 110956996) has the molecular formula C18H24N4O2 and a molecular weight of 328.42 g/mol. Its IUPAC name is 1-cyclohexyl-3-[2-(1,3-dioxoisoindol-2-yl)ethyl]-2-methylguanidine.
| Compound Name | 1-cyclohexyl-3-[2-(1,3-dioxoisoindol-2-yl)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 110956996 |
| Molecular Formula | C18H24N4O2 |
| Molecular Weight | 328.42 g/mol |
| Exact Mass | 328.19 |
| IUPAC Name | 1-cyclohexyl-3-[2-(1,3-dioxoisoindol-2-yl)ethyl]-2-methylguanidine |
| SMILES | C/N=C(\NCCN1C(=O)c2ccccc2C1=O)NC1CCCCC1 |
| InChI | InChI=1S/C18H24N4O2/c1-19-18(21-13-7-3-2-4-8-13)20-11-12-22-16(23)14-9-5-6-10-15(14)17(22)24/h5-6,9-10,13H,2-4,7-8,11-12H2,1H3,(H2,19,20,21) |
| InChIKey | OHSHCGGPOPTCPS-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.42 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|