C24H30N3O2+ — CID 6999506
2-[4-[4-(2,5-dimethylphenyl)piperazin-1-ium-1-yl]butyl]isoindole-1,3-dione (PubChem CID 6999506) has the molecular formula C24H30N3O2+ and a molecular weight of 392.52 g/mol. Its IUPAC name is 2-[4-[4-(2,5-dimethylphenyl)piperazin-1-ium-1-yl]butyl]isoindole-1,3-dione.
| Compound Name | 2-[4-[4-(2,5-dimethylphenyl)piperazin-1-ium-1-yl]butyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 6999506 |
| Molecular Formula | C24H30N3O2+ |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.23 |
| IUPAC Name | 2-[4-[4-(2,5-dimethylphenyl)piperazin-1-ium-1-yl]butyl]isoindole-1,3-dione |
| SMILES | Cc1ccc(C)c(N2CC[NH+](CCCCN3C(=O)c4ccccc4C3=O)CC2)c1 |
| InChI | InChI=1S/C24H29N3O2/c1-18-9-10-19(2)22(17-18)26-15-13-25(14-16-26)11-5-6-12-27-23(28)20-7-3-4-8-21(20)24(27)29/h3-4,7-10,17H,5-6,11-16H2,1-2H3/p+1 |
| InChIKey | PBYXRFVTABFPGW-UHFFFAOYSA-O |
| XLogP | 2.08 |
| TPSA | 45.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|