C25H29N2+ — CID 7441235
1-(2,5-dimethylphenyl)-4-[(4-phenylphenyl)methyl]piperazin-4-ium (PubChem CID 7441235) has the molecular formula C25H29N2+ and a molecular weight of 357.52 g/mol. Its IUPAC name is 1-(2,5-dimethylphenyl)-4-[(4-phenylphenyl)methyl]piperazin-4-ium.
| Compound Name | 1-(2,5-dimethylphenyl)-4-[(4-phenylphenyl)methyl]piperazin-4-ium |
|---|---|
| PubChem CID | 7441235 |
| Molecular Formula | C25H29N2+ |
| Molecular Weight | 357.52 g/mol |
| Exact Mass | 357.23 |
| IUPAC Name | 1-(2,5-dimethylphenyl)-4-[(4-phenylphenyl)methyl]piperazin-4-ium |
| SMILES | Cc1ccc(C)c(N2CC[NH+](Cc3ccc(-c4ccccc4)cc3)CC2)c1 |
| InChI | InChI=1S/C25H28N2/c1-20-8-9-21(2)25(18-20)27-16-14-26(15-17-27)19-22-10-12-24(13-11-22)23-6-4-3-5-7-23/h3-13,18H,14-17,19H2,1-2H3/p+1 |
| InChIKey | KFNAGRQLJNKEHU-UHFFFAOYSA-O |
| XLogP | 3.88 |
| TPSA | 7.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.52 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |