C21H23ClN3O3+ — CID 7802856
2-[3-[4-(2-chlorophenyl)piperazin-1-ium-1-yl]propoxy]isoindole-1,3-dione (PubChem CID 7802856) has the molecular formula C21H23ClN3O3+ and a molecular weight of 400.89 g/mol. Its IUPAC name is 2-[3-[4-(2-chlorophenyl)piperazin-1-ium-1-yl]propoxy]isoindole-1,3-dione.
| Compound Name | 2-[3-[4-(2-chlorophenyl)piperazin-1-ium-1-yl]propoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 7802856 |
| Molecular Formula | C21H23ClN3O3+ |
| Molecular Weight | 400.89 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | 2-[3-[4-(2-chlorophenyl)piperazin-1-ium-1-yl]propoxy]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1OCCC[NH+]1CCN(c2ccccc2Cl)CC1 |
| InChI | InChI=1S/C21H22ClN3O3/c22-18-8-3-4-9-19(18)24-13-11-23(12-14-24)10-5-15-28-25-20(26)16-6-1-2-7-17(16)21(25)27/h1-4,6-9H,5,10-15H2/p+1 |
| InChIKey | BOVDIQNGZQWEFK-UHFFFAOYSA-O |
| XLogP | 1.66 |
| TPSA | 54.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.89 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|