C26H31N7O2 — CID 10390113
(10S)-10-methyl-13-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraene-12,14-dione (PubChem CID 10390113) has the molecular formula C26H31N7O2 and a molecular weight of 473.58 g/mol. Its IUPAC name is (10S)-10-methyl-13-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraene-12,14-dione.
| Compound Name | (10S)-10-methyl-13-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraene-12,14-dione |
|---|---|
| PubChem CID | 10390113 |
| Molecular Formula | C26H31N7O2 |
| Molecular Weight | 473.58 g/mol |
| Exact Mass | 473.25 |
| IUPAC Name | (10S)-10-methyl-13-[4-(4-pyrimidin-2-ylpiperazin-1-yl)butyl]-8,11,13-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2,4,6-tetraene-12,14-dione |
| SMILES | C[C@H]1c2[nH]c3ccccc3c2CC2C(=O)N(CCCCN3CCN(c4ncccn4)CC3)C(=O)N21 |
| InChI | InChI=1S/C26H31N7O2/c1-18-23-20(19-7-2-3-8-21(19)29-23)17-22-24(34)32(26(35)33(18)22)12-5-4-11-30-13-15-31(16-14-30)25-27-9-6-10-28-25/h2-3,6-10,18,22,29H,4-5,11-17H2,1H3/t18-,22?/m0/s1 |
| InChIKey | WCKKKEJKJMBBGH-HXBUSHRASA-N |
| XLogP | 2.81 |
| TPSA | 88.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.58 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|