C19H25I2N3O2 — CID 158954132
ethane;molecular iodine;2,5,6-trimethyl-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione (PubChem CID 158954132) has the molecular formula C19H25I2N3O2 and a molecular weight of 581.24 g/mol. Its IUPAC name is ethane;molecular iodine;2,5,6-trimethyl-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione.
| Compound Name | ethane;molecular iodine;2,5,6-trimethyl-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
|---|---|
| PubChem CID | 158954132 |
| Molecular Formula | C19H25I2N3O2 |
| Molecular Weight | 581.24 g/mol |
| Exact Mass | 581.00 |
| IUPAC Name | ethane;molecular iodine;2,5,6-trimethyl-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
| SMILES | CC.CC1C(=O)N2C(Cc3c([nH]c4ccccc34)C2C)C(=O)N1C.II |
| InChI | InChI=1S/C17H19N3O2.C2H6.I2/c1-9-15-12(11-6-4-5-7-13(11)18-15)8-14-17(22)19(3)10(2)16(21)20(9)14;2*1-2/h4-7,9-10,14,18H,8H2,1-3H3;1-2H3; |
| InChIKey | JLUKEFOPDKXPCA-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 56.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.24 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|